C17H23NO3 — CID 62299898
6-(2-cyclopentyl-1-hydroxyethyl)-3-propyl-1,3-benzoxazol-2-one (PubChem CID 62299898) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 6-(2-cyclopentyl-1-hydroxyethyl)-3-propyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(2-cyclopentyl-1-hydroxyethyl)-3-propyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 62299898 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 6-(2-cyclopentyl-1-hydroxyethyl)-3-propyl-1,3-benzoxazol-2-one |
| SMILES | CCCn1c(=O)oc2cc(C(O)CC3CCCC3)ccc21 |
| InChI | InChI=1S/C17H23NO3/c1-2-9-18-14-8-7-13(11-16(14)21-17(18)20)15(19)10-12-5-3-4-6-12/h7-8,11-12,15,19H,2-6,9-10H2,1H3 |
| InChIKey | PHIBWPNWPSXMND-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |