C16H20ClNO4 — CID 12961165
methyl 8-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)octanoate (PubChem CID 12961165) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is methyl 8-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)octanoate.
| Compound Name | methyl 8-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)octanoate |
|---|---|
| PubChem CID | 12961165 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | methyl 8-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)octanoate |
| SMILES | COC(=O)CCCCCCCn1c(=O)oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H20ClNO4/c1-21-15(19)7-5-3-2-4-6-10-18-13-11-12(17)8-9-14(13)22-16(18)20/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | HAXKTAIYZUJVKQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|