C18H15ClN2O5 — CID 9138841
methyl 4-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate (PubChem CID 9138841) has the molecular formula C18H15ClN2O5 and a molecular weight of 374.78 g/mol. Its IUPAC name is methyl 4-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate.
| Compound Name | methyl 4-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 9138841 |
| Molecular Formula | C18H15ClN2O5 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | methyl 4-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CCn2c(=O)oc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C18H15ClN2O5/c1-25-17(23)11-2-5-13(6-3-11)20-16(22)8-9-21-14-7-4-12(19)10-15(14)26-18(21)24/h2-7,10H,8-9H2,1H3,(H,20,22) |
| InChIKey | KNBCETVOWVSGOR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |