C19H17ClN2O5 — CID 9228382
ethyl 3-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate (PubChem CID 9228382) has the molecular formula C19H17ClN2O5 and a molecular weight of 388.81 g/mol. Its IUPAC name is ethyl 3-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate.
| Compound Name | ethyl 3-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 9228382 |
| Molecular Formula | C19H17ClN2O5 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | ethyl 3-[3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)CCn2c(=O)oc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C19H17ClN2O5/c1-2-26-18(24)12-4-3-5-14(10-12)21-17(23)8-9-22-15-7-6-13(20)11-16(15)27-19(22)25/h3-7,10-11H,2,8-9H2,1H3,(H,21,23) |
| InChIKey | QJDJMKLEDXLGIL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |