C20H20N2O5 — CID 4805932
ethyl 4-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzoate (PubChem CID 4805932) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl 4-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzoate.
| Compound Name | ethyl 4-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 4805932 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | ethyl 4-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCCn2c(=O)oc3ccccc32)cc1 |
| InChI | InChI=1S/C20H20N2O5/c1-2-26-19(24)14-9-11-15(12-10-14)21-18(23)8-5-13-22-16-6-3-4-7-17(16)27-20(22)25/h3-4,6-7,9-12H,2,5,8,13H2,1H3,(H,21,23) |
| InChIKey | AGXQORMLWAHWJL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |