C22H25N3O4 — CID 31290190
N,N-diethyl-3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzamide (PubChem CID 31290190) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N,N-diethyl-3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzamide.
| Compound Name | N,N-diethyl-3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzamide |
|---|---|
| PubChem CID | 31290190 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N,N-diethyl-3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)CCCn2c(=O)oc3ccccc32)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-3-24(4-2)21(27)16-9-7-10-17(15-16)23-20(26)13-8-14-25-18-11-5-6-12-19(18)29-22(25)28/h5-7,9-12,15H,3-4,8,13-14H2,1-2H3,(H,23,26) |
| InChIKey | KKBHBTAZQVZYKG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |