C21H20N4O5 — CID 51949462
N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-4-(2-oxo-1,3-benzoxazol-3-yl)butanamide (PubChem CID 51949462) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-4-(2-oxo-1,3-benzoxazol-3-yl)butanamide.
| Compound Name | N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-4-(2-oxo-1,3-benzoxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 51949462 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-4-(2-oxo-1,3-benzoxazol-3-yl)butanamide |
| SMILES | C[C@]1(c2cccc(NC(=O)CCCn3c(=O)oc4ccccc43)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H20N4O5/c1-21(18(27)23-19(28)24-21)13-6-4-7-14(12-13)22-17(26)10-5-11-25-15-8-2-3-9-16(15)30-20(25)29/h2-4,6-9,12H,5,10-11H2,1H3,(H,22,26)(H2,23,24,27,28)/t21-/m1/s1 |
| InChIKey | XSTFXSSIOWMECM-OAQYLSRUSA-N |
| XLogP | 2.07 |
| TPSA | 122.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|