C17H24N4O3 — CID 119728470
7-amino-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]heptanamide (PubChem CID 119728470) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 7-amino-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]heptanamide.
| Compound Name | 7-amino-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]heptanamide |
|---|---|
| PubChem CID | 119728470 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 7-amino-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]heptanamide |
| SMILES | CC1(c2cccc(NC(=O)CCCCCCN)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C17H24N4O3/c1-17(15(23)20-16(24)21-17)12-7-6-8-13(11-12)19-14(22)9-4-2-3-5-10-18/h6-8,11H,2-5,9-10,18H2,1H3,(H,19,22)(H2,20,21,23,24) |
| InChIKey | BKNZIWIPGXCXGS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|