C21H19N5O4 — CID 51949326
N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-3-(4-oxoquinazolin-3-yl)propanamide (PubChem CID 51949326) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-3-(4-oxoquinazolin-3-yl)propanamide.
| Compound Name | N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-3-(4-oxoquinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 51949326 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-3-(4-oxoquinazolin-3-yl)propanamide |
| SMILES | C[C@@]1(c2cccc(NC(=O)CCn3cnc4ccccc4c3=O)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H19N5O4/c1-21(19(29)24-20(30)25-21)13-5-4-6-14(11-13)23-17(27)9-10-26-12-22-16-8-3-2-7-15(16)18(26)28/h2-8,11-12H,9-10H2,1H3,(H,23,27)(H2,24,25,29,30)/t21-/m0/s1 |
| InChIKey | HKOJVAZMCVDCOP-NRFANRHFSA-N |
| XLogP | 1.48 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|