C15H13N3O3S — CID 51983587
N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]thiophene-2-carboxamide (PubChem CID 51983587) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 51983587 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]thiophene-2-carboxamide |
| SMILES | C[C@@]1(c2cccc(NC(=O)c3cccs3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C15H13N3O3S/c1-15(13(20)17-14(21)18-15)9-4-2-5-10(8-9)16-12(19)11-6-3-7-22-11/h2-8H,1H3,(H,16,19)(H2,17,18,20,21)/t15-/m0/s1 |
| InChIKey | UFBODBVFMSUCSV-HNNXBMFYSA-N |
| XLogP | 2.06 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|