C21H18N4O4 — CID 154850134
3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(4-methyl-2-oxo-1H-quinolin-6-yl)benzamide (PubChem CID 154850134) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(4-methyl-2-oxo-1H-quinolin-6-yl)benzamide.
| Compound Name | 3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(4-methyl-2-oxo-1H-quinolin-6-yl)benzamide |
|---|---|
| PubChem CID | 154850134 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 3-(4-methyl-2,5-dioxoimidazolidin-4-yl)-N-(4-methyl-2-oxo-1H-quinolin-6-yl)benzamide |
| SMILES | Cc1cc(=O)[nH]c2ccc(NC(=O)c3cccc(C4(C)NC(=O)NC4=O)c3)cc12 |
| InChI | InChI=1S/C21H18N4O4/c1-11-8-17(26)23-16-7-6-14(10-15(11)16)22-18(27)12-4-3-5-13(9-12)21(2)19(28)24-20(29)25-21/h3-10H,1-2H3,(H,22,27)(H,23,26)(H2,24,25,28,29) |
| InChIKey | LGNSRGLAQQMMFI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|