C22H17ClN4O4 — CID 166226982
N-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzamide (PubChem CID 166226982) has the molecular formula C22H17ClN4O4 and a molecular weight of 436.86 g/mol. Its IUPAC name is N-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzamide.
| Compound Name | N-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzamide |
|---|---|
| PubChem CID | 166226982 |
| Molecular Formula | C22H17ClN4O4 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]-3-(4-methyl-2,5-dioxoimidazolidin-4-yl)benzamide |
| SMILES | CC1(c2cccc(C(=O)Nc3ccc(Oc4ccc(Cl)cn4)cc3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C22H17ClN4O4/c1-22(20(29)26-21(30)27-22)14-4-2-3-13(11-14)19(28)25-16-6-8-17(9-7-16)31-18-10-5-15(23)12-24-18/h2-12H,1H3,(H,25,28)(H2,26,27,29,30) |
| InChIKey | PPYGBTRETALKBJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|