C19H17F2N3O5 — CID 6991484
N-[4-(difluoromethoxy)phenyl]-2-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]acetamide (PubChem CID 6991484) has the molecular formula C19H17F2N3O5 and a molecular weight of 405.36 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 6991484 |
| Molecular Formula | C19H17F2N3O5 |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenoxy]acetamide |
| SMILES | C[C@]1(c2cccc(OCC(=O)Nc3ccc(OC(F)F)cc3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H17F2N3O5/c1-19(16(26)23-18(27)24-19)11-3-2-4-14(9-11)28-10-15(25)22-12-5-7-13(8-6-12)29-17(20)21/h2-9,17H,10H2,1H3,(H,22,25)(H2,23,24,26,27)/t19-/m1/s1 |
| InChIKey | MHVVRUUCJKPYOD-LJQANCHMSA-N |
| XLogP | 2.36 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|