C19H18ClN3O4 — CID 55961363
3-(3-chlorophenoxy)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]propanamide (PubChem CID 55961363) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]propanamide.
| Compound Name | 3-(3-chlorophenoxy)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 55961363 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3-(3-chlorophenoxy)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]propanamide |
| SMILES | CC1(c2cccc(NC(=O)CCOc3cccc(Cl)c3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H18ClN3O4/c1-19(17(25)22-18(26)23-19)12-4-2-6-14(10-12)21-16(24)8-9-27-15-7-3-5-13(20)11-15/h2-7,10-11H,8-9H2,1H3,(H,21,24)(H2,22,23,25,26) |
| InChIKey | IWIKPASMIBHJJO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|