C21H21N3O3 — CID 52502832
2-(2,3-dihydro-1H-inden-5-yl)-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]acetamide (PubChem CID 52502832) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]acetamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 52502832 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]acetamide |
| SMILES | C[C@@]1(c2cccc(NC(=O)Cc3ccc4c(c3)CCC4)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H21N3O3/c1-21(19(26)23-20(27)24-21)16-6-3-7-17(12-16)22-18(25)11-13-8-9-14-4-2-5-15(14)10-13/h3,6-10,12H,2,4-5,11H2,1H3,(H,22,25)(H2,23,24,26,27)/t21-/m0/s1 |
| InChIKey | UQGJIGFNTTYRMU-NRFANRHFSA-N |
| XLogP | 2.41 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|