C17H17N3O3S — CID 129368217
N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-2-(5-methylthiophen-2-yl)acetamide (PubChem CID 129368217) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-2-(5-methylthiophen-2-yl)acetamide.
| Compound Name | N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-2-(5-methylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 129368217 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-2-(5-methylthiophen-2-yl)acetamide |
| SMILES | Cc1ccc(CC(=O)Nc2cccc([C@@]3(C)NC(=O)NC3=O)c2)s1 |
| InChI | InChI=1S/C17H17N3O3S/c1-10-6-7-13(24-10)9-14(21)18-12-5-3-4-11(8-12)17(2)15(22)19-16(23)20-17/h3-8H,9H2,1-2H3,(H,18,21)(H2,19,20,22,23)/t17-/m1/s1 |
| InChIKey | KHEMUCFNGJAXFZ-QGZVFWFLSA-N |
| XLogP | 2.29 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|