C20H18N4O5 — CID 51949270
N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 51949270) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 51949270 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-2-(3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | C[C@@]1(c2cccc(NC(=O)CN3C(=O)COc4ccccc43)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C20H18N4O5/c1-20(18(27)22-19(28)23-20)12-5-4-6-13(9-12)21-16(25)10-24-14-7-2-3-8-15(14)29-11-17(24)26/h2-9H,10-11H2,1H3,(H,21,25)(H2,22,23,27,28)/t20-/m0/s1 |
| InChIKey | QBEHTZCVCXABOC-FQEVSTJZSA-N |
| XLogP | 1.11 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|