C13H17ClN4O3 — CID 119728481
2-(methylamino)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]acetamide;hydrochloride (PubChem CID 119728481) has the molecular formula C13H17ClN4O3 and a molecular weight of 312.76 g/mol. Its IUPAC name is 2-(methylamino)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-(methylamino)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119728481 |
| Molecular Formula | C13H17ClN4O3 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-(methylamino)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]acetamide;hydrochloride |
| SMILES | CNCC(=O)Nc1cccc(C2(C)NC(=O)NC2=O)c1.Cl |
| InChI | InChI=1S/C13H16N4O3.ClH/c1-13(11(19)16-12(20)17-13)8-4-3-5-9(6-8)15-10(18)7-14-2;/h3-6,14H,7H2,1-2H3,(H,15,18)(H2,16,17,19,20);1H |
| InChIKey | BQFVHJZOOYSWBE-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|