C21H22BrN3O3 — CID 60513548
5-(4-bromophenyl)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]pentanamide (PubChem CID 60513548) has the molecular formula C21H22BrN3O3 and a molecular weight of 444.33 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]pentanamide.
| Compound Name | 5-(4-bromophenyl)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 60513548 |
| Molecular Formula | C21H22BrN3O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 5-(4-bromophenyl)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]pentanamide |
| SMILES | CC1(c2cccc(NC(=O)CCCCc3ccc(Br)cc3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H22BrN3O3/c1-21(19(27)24-20(28)25-21)15-6-4-7-17(13-15)23-18(26)8-3-2-5-14-9-11-16(22)12-10-14/h4,6-7,9-13H,2-3,5,8H2,1H3,(H,23,26)(H2,24,25,27,28) |
| InChIKey | ZLEZHFRREHYFIW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|