C19H23N5O4 — CID 51949351
3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]propanamide (PubChem CID 51949351) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]propanamide.
| Compound Name | 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 51949351 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]propanamide |
| SMILES | CC(C)(C)c1noc(CCC(=O)Nc2cccc([C@]3(C)NC(=O)NC3=O)c2)n1 |
| InChI | InChI=1S/C19H23N5O4/c1-18(2,3)15-21-14(28-24-15)9-8-13(25)20-12-7-5-6-11(10-12)19(4)16(26)22-17(27)23-19/h5-7,10H,8-9H2,1-4H3,(H,20,25)(H2,22,23,26,27)/t19-/m0/s1 |
| InChIKey | AEIANTGQOGVFDB-IBGZPJMESA-N |
| XLogP | 1.99 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|