C24H24N4O4 — CID 56506786
4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]butanamide (PubChem CID 56506786) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]butanamide.
| Compound Name | 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 56506786 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]butanamide |
| SMILES | CC(C)(C)c1noc(CCCC(=O)Nc2cccc(N3C(=O)c4ccccc4C3=O)c2)n1 |
| InChI | InChI=1S/C24H24N4O4/c1-24(2,3)23-26-20(32-27-23)13-7-12-19(29)25-15-8-6-9-16(14-15)28-21(30)17-10-4-5-11-18(17)22(28)31/h4-6,8-11,14H,7,12-13H2,1-3H3,(H,25,29) |
| InChIKey | FERIPVAWSLHZBC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|