C24H22N4O3S — CID 56507566
3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]propanamide (PubChem CID 56507566) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]propanamide.
| Compound Name | 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 56507566 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]propanamide |
| SMILES | CSc1nc(C)c(CCC(=O)Nc2cccc(N3C(=O)c4ccccc4C3=O)c2)c(C)n1 |
| InChI | InChI=1S/C24H22N4O3S/c1-14-18(15(2)26-24(25-14)32-3)11-12-21(29)27-16-7-6-8-17(13-16)28-22(30)19-9-4-5-10-20(19)23(28)31/h4-10,13H,11-12H2,1-3H3,(H,27,29) |
| InChIKey | NJRMYGQVLQLAMW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|