C19H18N2O3 — CID 960947
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2,2-dimethylpropanamide (PubChem CID 960947) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 960947 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C19H18N2O3/c1-19(2,3)18(24)20-12-7-6-8-13(11-12)21-16(22)14-9-4-5-10-15(14)17(21)23/h4-11H,1-3H3,(H,20,24) |
| InChIKey | FDRRYDZSBCNHED-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|