C22H13F3N2O3S — CID 56508199
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-(trifluoromethylsulfanyl)benzamide (PubChem CID 56508199) has the molecular formula C22H13F3N2O3S and a molecular weight of 442.42 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 56508199 |
| Molecular Formula | C22H13F3N2O3S |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-2-(trifluoromethylsulfanyl)benzamide |
| SMILES | O=C(Nc1cccc(N2C(=O)c3ccccc3C2=O)c1)c1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C22H13F3N2O3S/c23-22(24,25)31-18-11-4-3-10-17(18)19(28)26-13-6-5-7-14(12-13)27-20(29)15-8-1-2-9-16(15)21(27)30/h1-12H,(H,26,28) |
| InChIKey | BHSVKVYWGWVGFD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|