C21H11Cl2FN2O3 — CID 56506673
2,4-dichloro-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-5-fluorobenzamide (PubChem CID 56506673) has the molecular formula C21H11Cl2FN2O3 and a molecular weight of 429.23 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 56506673 |
| Molecular Formula | C21H11Cl2FN2O3 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 2,4-dichloro-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-5-fluorobenzamide |
| SMILES | O=C(Nc1cccc(N2C(=O)c3ccccc3C2=O)c1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H11Cl2FN2O3/c22-16-10-17(23)18(24)9-15(16)19(27)25-11-4-3-5-12(8-11)26-20(28)13-6-1-2-7-14(13)21(26)29/h1-10H,(H,25,27) |
| InChIKey | NYGKITQULAWXEF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|