C23H14F2N2O3 — CID 56507424
(E)-3-(2,6-difluorophenyl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]prop-2-enamide (PubChem CID 56507424) has the molecular formula C23H14F2N2O3 and a molecular weight of 404.37 g/mol. Its IUPAC name is (E)-3-(2,6-difluorophenyl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-difluorophenyl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 56507424 |
| Molecular Formula | C23H14F2N2O3 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (E)-3-(2,6-difluorophenyl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1c(F)cccc1F)Nc1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H14F2N2O3/c24-19-9-4-10-20(25)18(19)11-12-21(28)26-14-5-3-6-15(13-14)27-22(29)16-7-1-2-8-17(16)23(27)30/h1-13H,(H,26,28)/b12-11+ |
| InChIKey | BVDIVYJZPKJQOO-VAWYXSNFSA-N |
| XLogP | 4.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|