C23H15N3O5 — CID 56507188
(E)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 56507188) has the molecular formula C23H15N3O5 and a molecular weight of 413.39 g/mol. Its IUPAC name is (E)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 56507188 |
| Molecular Formula | C23H15N3O5 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | (E)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Nc1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H15N3O5/c27-21(12-11-15-5-3-8-18(13-15)26(30)31)24-16-6-4-7-17(14-16)25-22(28)19-9-1-2-10-20(19)23(25)29/h1-14H,(H,24,27)/b12-11+ |
| InChIKey | VDBYGXGIQMPWKG-VAWYXSNFSA-N |
| XLogP | 4.05 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|