C25H17N3O3 — CID 56507056
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-pyrrol-1-ylbenzamide (PubChem CID 56507056) has the molecular formula C25H17N3O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-pyrrol-1-ylbenzamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 56507056 |
| Molecular Formula | C25H17N3O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-pyrrol-1-ylbenzamide |
| SMILES | O=C(Nc1cccc(N2C(=O)c3ccccc3C2=O)c1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C25H17N3O3/c29-23(17-10-12-19(13-11-17)27-14-3-4-15-27)26-18-6-5-7-20(16-18)28-24(30)21-8-1-2-9-22(21)25(28)31/h1-16H,(H,26,29) |
| InChIKey | IZUZAEHXKOCJJU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|