C28H17I2N3O4 — CID 3492403
N-(3-iodophenyl)-2-[3-[(3-iodophenyl)carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 3492403) has the molecular formula C28H17I2N3O4 and a molecular weight of 713.27 g/mol. Its IUPAC name is N-(3-iodophenyl)-2-[3-[(3-iodophenyl)carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(3-iodophenyl)-2-[3-[(3-iodophenyl)carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 3492403 |
| Molecular Formula | C28H17I2N3O4 |
| Molecular Weight | 713.27 g/mol |
| Exact Mass | 712.93 |
| IUPAC Name | N-(3-iodophenyl)-2-[3-[(3-iodophenyl)carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1cccc(I)c1)c1cccc(N2C(=O)c3ccc(C(=O)Nc4cccc(I)c4)cc3C2=O)c1 |
| InChI | InChI=1S/C28H17I2N3O4/c29-18-5-2-7-20(14-18)31-25(34)16-4-1-9-22(12-16)33-27(36)23-11-10-17(13-24(23)28(33)37)26(35)32-21-8-3-6-19(30)15-21/h1-15H,(H,31,34)(H,32,35) |
| InChIKey | NODVIVZVCVVEBF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.27 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|