C23H17N3O5 — CID 23850036
methyl 3-[5-[(4-aminobenzoyl)amino]-1,3-dioxoisoindol-2-yl]benzoate (PubChem CID 23850036) has the molecular formula C23H17N3O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is methyl 3-[5-[(4-aminobenzoyl)amino]-1,3-dioxoisoindol-2-yl]benzoate.
| Compound Name | methyl 3-[5-[(4-aminobenzoyl)amino]-1,3-dioxoisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 23850036 |
| Molecular Formula | C23H17N3O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | methyl 3-[5-[(4-aminobenzoyl)amino]-1,3-dioxoisoindol-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)c3ccc(NC(=O)c4ccc(N)cc4)cc3C2=O)c1 |
| InChI | InChI=1S/C23H17N3O5/c1-31-23(30)14-3-2-4-17(11-14)26-21(28)18-10-9-16(12-19(18)22(26)29)25-20(27)13-5-7-15(24)8-6-13/h2-12H,24H2,1H3,(H,25,27) |
| InChIKey | WLVUHRWTECRUCT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|