C25H20N2O5 — CID 19177391
propyl 3-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]benzoate (PubChem CID 19177391) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is propyl 3-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]benzoate.
| Compound Name | propyl 3-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 19177391 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | propyl 3-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cccc(NC(=O)c2cccc(N3C(=O)c4ccccc4C3=O)c2)c1 |
| InChI | InChI=1S/C25H20N2O5/c1-2-13-32-25(31)17-8-5-9-18(14-17)26-22(28)16-7-6-10-19(15-16)27-23(29)20-11-3-4-12-21(20)24(27)30/h3-12,14-15H,2,13H2,1H3,(H,26,28) |
| InChIKey | YNHQFBWZFQNFTF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|