C24H18N2O7S — CID 55465190
[2-(4-methylsulfonylanilino)-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 55465190) has the molecular formula C24H18N2O7S and a molecular weight of 478.48 g/mol. Its IUPAC name is [2-(4-methylsulfonylanilino)-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-(4-methylsulfonylanilino)-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 55465190 |
| Molecular Formula | C24H18N2O7S |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | [2-(4-methylsulfonylanilino)-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)COC(=O)c2cccc(N3C(=O)c4ccccc4C3=O)c2)cc1 |
| InChI | InChI=1S/C24H18N2O7S/c1-34(31,32)18-11-9-16(10-12-18)25-21(27)14-33-24(30)15-5-4-6-17(13-15)26-22(28)19-7-2-3-8-20(19)23(26)29/h2-13H,14H2,1H3,(H,25,27) |
| InChIKey | FWHASUMALXFDLS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|