C22H22N2O7S — CID 55926112
[2-(4-methylsulfonylanilino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 55926112) has the molecular formula C22H22N2O7S and a molecular weight of 458.49 g/mol. Its IUPAC name is [2-(4-methylsulfonylanilino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
| Compound Name | [2-(4-methylsulfonylanilino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 55926112 |
| Molecular Formula | C22H22N2O7S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | [2-(4-methylsulfonylanilino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)OCC(=O)Nc1ccc(S(C)(=O)=O)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H22N2O7S/c1-13(2)19(24-20(26)16-6-4-5-7-17(16)21(24)27)22(28)31-12-18(25)23-14-8-10-15(11-9-14)32(3,29)30/h4-11,13,19H,12H2,1-3H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | ONWNGYCKPMOKGP-IBGZPJMESA-N |
| XLogP | 1.89 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|