C25H20N2O7S — CID 55468463
[2-(4-methylsulfonylanilino)-2-oxoethyl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate (PubChem CID 55468463) has the molecular formula C25H20N2O7S and a molecular weight of 492.51 g/mol. Its IUPAC name is [2-(4-methylsulfonylanilino)-2-oxoethyl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate.
| Compound Name | [2-(4-methylsulfonylanilino)-2-oxoethyl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 55468463 |
| Molecular Formula | C25H20N2O7S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | [2-(4-methylsulfonylanilino)-2-oxoethyl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)COC(=O)c2cccc(CN3C(=O)c4ccccc4C3=O)c2)cc1 |
| InChI | InChI=1S/C25H20N2O7S/c1-35(32,33)19-11-9-18(10-12-19)26-22(28)15-34-25(31)17-6-4-5-16(13-17)14-27-23(29)20-7-2-3-8-21(20)24(27)30/h2-13H,14-15H2,1H3,(H,26,28) |
| InChIKey | OWHJHWKTJLMQED-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|