C26H22N2O6 — CID 3912958
[2-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate (PubChem CID 3912958) has the molecular formula C26H22N2O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is [2-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate.
| Compound Name | [2-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 3912958 |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [2-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)COC(=O)c2cccc(CN3C(=O)c4ccccc4C3=O)c2)c1C |
| InChI | InChI=1S/C26H22N2O6/c1-14-22(16(3)29)15(2)27-23(14)21(30)13-34-26(33)18-8-6-7-17(11-18)12-28-24(31)19-9-4-5-10-20(19)25(28)32/h4-11,27H,12-13H2,1-3H3 |
| InChIKey | CDOJTGPTDOSHME-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|