C24H16BrNO5 — CID 4680222
[2-(4-bromophenyl)-2-oxoethyl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate (PubChem CID 4680222) has the molecular formula C24H16BrNO5 and a molecular weight of 478.30 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 4680222 |
| Molecular Formula | C24H16BrNO5 |
| Molecular Weight | 478.30 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 3-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
| SMILES | O=C(COC(=O)c1cccc(CN2C(=O)c3ccccc3C2=O)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H16BrNO5/c25-18-10-8-16(9-11-18)21(27)14-31-24(30)17-5-3-4-15(12-17)13-26-22(28)19-6-1-2-7-20(19)23(26)29/h1-12H,13-14H2 |
| InChIKey | DPDHDSNUQWNYHW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|