C20H18N2O7S — CID 55393518
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate (PubChem CID 55393518) has the molecular formula C20H18N2O7S and a molecular weight of 430.44 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 55393518 |
| Molecular Formula | C20H18N2O7S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate |
| SMILES | CN1C(=O)c2ccc(NC(=O)COC(=O)c3cccc(CS(C)(=O)=O)c3)cc2C1=O |
| InChI | InChI=1S/C20H18N2O7S/c1-22-18(24)15-7-6-14(9-16(15)19(22)25)21-17(23)10-29-20(26)13-5-3-4-12(8-13)11-30(2,27)28/h3-9H,10-11H2,1-2H3,(H,21,23) |
| InChIKey | LYRJTWNNPQGXTC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|