C22H21N3O8S — CID 55379667
[2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-(cyclopropylsulfamoyl)-4-methoxybenzoate (PubChem CID 55379667) has the molecular formula C22H21N3O8S and a molecular weight of 487.49 g/mol. Its IUPAC name is [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-(cyclopropylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 55379667 |
| Molecular Formula | C22H21N3O8S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | [2-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]-2-oxoethyl] 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)N(C)C3=O)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C22H21N3O8S/c1-25-20(27)15-7-6-14(10-16(15)21(25)28)23-19(26)11-33-22(29)12-3-8-17(32-2)18(9-12)34(30,31)24-13-4-5-13/h3,6-10,13,24H,4-5,11H2,1-2H3,(H,23,26) |
| InChIKey | XVLVFJLYZBZUIH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|