C20H22N2O6S — CID 9228353
ethyl 3-[[3-(cyclopropylsulfamoyl)-4-methoxybenzoyl]amino]benzoate (PubChem CID 9228353) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is ethyl 3-[[3-(cyclopropylsulfamoyl)-4-methoxybenzoyl]amino]benzoate.
| Compound Name | ethyl 3-[[3-(cyclopropylsulfamoyl)-4-methoxybenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 9228353 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | ethyl 3-[[3-(cyclopropylsulfamoyl)-4-methoxybenzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)c2ccc(OC)c(S(=O)(=O)NC3CC3)c2)c1 |
| InChI | InChI=1S/C20H22N2O6S/c1-3-28-20(24)14-5-4-6-16(11-14)21-19(23)13-7-10-17(27-2)18(12-13)29(25,26)22-15-8-9-15/h4-7,10-12,15,22H,3,8-9H2,1-2H3,(H,21,23) |
| InChIKey | MUDYBAOPZYUMEI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |