C20H22N2O4S3 — CID 26381192
3-(cyclopropylsulfamoyl)-N-[3-(1,3-dithiolan-2-yl)phenyl]-4-methoxybenzamide (PubChem CID 26381192) has the molecular formula C20H22N2O4S3 and a molecular weight of 450.61 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-N-[3-(1,3-dithiolan-2-yl)phenyl]-4-methoxybenzamide.
| Compound Name | 3-(cyclopropylsulfamoyl)-N-[3-(1,3-dithiolan-2-yl)phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 26381192 |
| Molecular Formula | C20H22N2O4S3 |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-N-[3-(1,3-dithiolan-2-yl)phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(C3SCCS3)c2)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C20H22N2O4S3/c1-26-17-8-5-13(12-18(17)29(24,25)22-15-6-7-15)19(23)21-16-4-2-3-14(11-16)20-27-9-10-28-20/h2-5,8,11-12,15,20,22H,6-7,9-10H2,1H3,(H,21,23) |
| InChIKey | DHLIDKZKSWHZBI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |