C17H17NO3S3 — CID 27889138
N-[3-(1,3-dithiolan-2-yl)phenyl]-3-methylsulfonylbenzamide (PubChem CID 27889138) has the molecular formula C17H17NO3S3 and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 27889138 |
| Molecular Formula | C17H17NO3S3 |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)Nc2cccc(C3SCCS3)c2)c1 |
| InChI | InChI=1S/C17H17NO3S3/c1-24(20,21)15-7-3-4-12(11-15)16(19)18-14-6-2-5-13(10-14)17-22-8-9-23-17/h2-7,10-11,17H,8-9H2,1H3,(H,18,19) |
| InChIKey | NMIUIUGJBUPAEN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |