C19H22N2O3S3 — CID 27842666
4-(dimethylsulfamoyl)-N-[3-(1,3-dithian-2-yl)phenyl]benzamide (PubChem CID 27842666) has the molecular formula C19H22N2O3S3 and a molecular weight of 422.60 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[3-(1,3-dithian-2-yl)phenyl]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[3-(1,3-dithian-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 27842666 |
| Molecular Formula | C19H22N2O3S3 |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[3-(1,3-dithian-2-yl)phenyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2cccc(C3SCCCS3)c2)cc1 |
| InChI | InChI=1S/C19H22N2O3S3/c1-21(2)27(23,24)17-9-7-14(8-10-17)18(22)20-16-6-3-5-15(13-16)19-25-11-4-12-26-19/h3,5-10,13,19H,4,11-12H2,1-2H3,(H,20,22) |
| InChIKey | GKTMBUTUCSHMSI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |