C19H20N2O2S2 — CID 18208547
3-[[4-(1,3-dithian-2-yl)benzoyl]amino]-N-methylbenzamide (PubChem CID 18208547) has the molecular formula C19H20N2O2S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is 3-[[4-(1,3-dithian-2-yl)benzoyl]amino]-N-methylbenzamide.
| Compound Name | 3-[[4-(1,3-dithian-2-yl)benzoyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 18208547 |
| Molecular Formula | C19H20N2O2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 3-[[4-(1,3-dithian-2-yl)benzoyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2ccc(C3SCCCS3)cc2)c1 |
| InChI | InChI=1S/C19H20N2O2S2/c1-20-17(22)15-4-2-5-16(12-15)21-18(23)13-6-8-14(9-7-13)19-24-10-3-11-25-19/h2,4-9,12,19H,3,10-11H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | KAUQLSDCLVTGBH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |