C24H28N4O4 — CID 17233453
1-N,4-N-bis[3-(methylcarbamoyl)phenyl]cyclohexane-1,4-dicarboxamide (PubChem CID 17233453) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-N,4-N-bis[3-(methylcarbamoyl)phenyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[3-(methylcarbamoyl)phenyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 17233453 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 1-N,4-N-bis[3-(methylcarbamoyl)phenyl]cyclohexane-1,4-dicarboxamide |
| SMILES | CNC(=O)c1cccc(NC(=O)C2CCC(C(=O)Nc3cccc(C(=O)NC)c3)CC2)c1 |
| InChI | InChI=1S/C24H28N4O4/c1-25-21(29)17-5-3-7-19(13-17)27-23(31)15-9-11-16(12-10-15)24(32)28-20-8-4-6-18(14-20)22(30)26-2/h3-8,13-16H,9-12H2,1-2H3,(H,25,29)(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | RCEWUXWKBZWYNZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |