C17H16N2O3 — CID 29260677
3-(cyclopropanecarbonylamino)-N-(2-hydroxyphenyl)benzamide (PubChem CID 29260677) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-(cyclopropanecarbonylamino)-N-(2-hydroxyphenyl)benzamide.
| Compound Name | 3-(cyclopropanecarbonylamino)-N-(2-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 29260677 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-(cyclopropanecarbonylamino)-N-(2-hydroxyphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1O)c1cccc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C17H16N2O3/c20-15-7-2-1-6-14(15)19-17(22)12-4-3-5-13(10-12)18-16(21)11-8-9-11/h1-7,10-11,20H,8-9H2,(H,18,21)(H,19,22) |
| InChIKey | NZGOZOKPSLCYGU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|