C22H24N2O3 — CID 55666415
N-(2-acetylphenyl)-3-(cyclohexanecarbonylamino)benzamide (PubChem CID 55666415) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-(2-acetylphenyl)-3-(cyclohexanecarbonylamino)benzamide.
| Compound Name | N-(2-acetylphenyl)-3-(cyclohexanecarbonylamino)benzamide |
|---|---|
| PubChem CID | 55666415 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-(2-acetylphenyl)-3-(cyclohexanecarbonylamino)benzamide |
| SMILES | CC(=O)c1ccccc1NC(=O)c1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C22H24N2O3/c1-15(25)19-12-5-6-13-20(19)24-22(27)17-10-7-11-18(14-17)23-21(26)16-8-3-2-4-9-16/h5-7,10-14,16H,2-4,8-9H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | DXZBGVYXYJAZGB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |