C20H24ClN3O2 — CID 119814644
3-amino-N-[3-(cyclohexanecarbonylamino)phenyl]benzamide;hydrochloride (PubChem CID 119814644) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is 3-amino-N-[3-(cyclohexanecarbonylamino)phenyl]benzamide;hydrochloride.
| Compound Name | 3-amino-N-[3-(cyclohexanecarbonylamino)phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119814644 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3-amino-N-[3-(cyclohexanecarbonylamino)phenyl]benzamide;hydrochloride |
| SMILES | Cl.Nc1cccc(C(=O)Nc2cccc(NC(=O)C3CCCCC3)c2)c1 |
| InChI | InChI=1S/C20H23N3O2.ClH/c21-16-9-4-8-15(12-16)20(25)23-18-11-5-10-17(13-18)22-19(24)14-6-2-1-3-7-14;/h4-5,8-14H,1-3,6-7,21H2,(H,22,24)(H,23,25);1H |
| InChIKey | AWAJUKAECUZFGU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|