C23H30ClN3O2 — CID 119440451
3-(cyclohexanecarbonylamino)-N-[2-(ethylaminomethyl)phenyl]benzamide;hydrochloride (PubChem CID 119440451) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 3-(cyclohexanecarbonylamino)-N-[2-(ethylaminomethyl)phenyl]benzamide;hydrochloride.
| Compound Name | 3-(cyclohexanecarbonylamino)-N-[2-(ethylaminomethyl)phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119440451 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-(cyclohexanecarbonylamino)-N-[2-(ethylaminomethyl)phenyl]benzamide;hydrochloride |
| SMILES | CCNCc1ccccc1NC(=O)c1cccc(NC(=O)C2CCCCC2)c1.Cl |
| InChI | InChI=1S/C23H29N3O2.ClH/c1-2-24-16-19-11-6-7-14-21(19)26-23(28)18-12-8-13-20(15-18)25-22(27)17-9-4-3-5-10-17;/h6-8,11-15,17,24H,2-5,9-10,16H2,1H3,(H,25,27)(H,26,28);1H |
| InChIKey | JYSNLZDFAAJQRO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |