C17H24N2O3 — CID 78866245
3-(cyclohexanecarbonylamino)-N-(2-hydroxypropyl)benzamide (PubChem CID 78866245) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-(cyclohexanecarbonylamino)-N-(2-hydroxypropyl)benzamide.
| Compound Name | 3-(cyclohexanecarbonylamino)-N-(2-hydroxypropyl)benzamide |
|---|---|
| PubChem CID | 78866245 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 3-(cyclohexanecarbonylamino)-N-(2-hydroxypropyl)benzamide |
| SMILES | CC(O)CNC(=O)c1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-12(20)11-18-16(21)14-8-5-9-15(10-14)19-17(22)13-6-3-2-4-7-13/h5,8-10,12-13,20H,2-4,6-7,11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | ZJCRWCRKMAUXDN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |