C19H26N2O4 — CID 75429563
3-[[3-(cyclohexanecarbonylamino)benzoyl]amino]-2,2-dimethylpropanoic acid (PubChem CID 75429563) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[[3-(cyclohexanecarbonylamino)benzoyl]amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[3-(cyclohexanecarbonylamino)benzoyl]amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 75429563 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-[[3-(cyclohexanecarbonylamino)benzoyl]amino]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CNC(=O)c1cccc(NC(=O)C2CCCCC2)c1)C(=O)O |
| InChI | InChI=1S/C19H26N2O4/c1-19(2,18(24)25)12-20-16(22)14-9-6-10-15(11-14)21-17(23)13-7-4-3-5-8-13/h6,9-11,13H,3-5,7-8,12H2,1-2H3,(H,20,22)(H,21,23)(H,24,25) |
| InChIKey | LLHSTAFSOOHCNF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |